Home
>
Chemical Reagents>Heterocyclic Building Blocks> (2S,4S)-4-(((Benzyloxy)carbonyl)amino)pyrrolidine-2-carboxylic acid
For research use only. Not for therapeutic Use.
(2S,4S)-4-(((Benzyloxy)carbonyl)amino)pyrrolidine-2-carboxylic acid(Cat No.:L006817), is a complex organic compound with significant relevance in pharmaceutical research. Its molecular structure consists of a pyrrolidine ring containing a carbonyl group and a benzyl group. This compound serves as a key intermediate in the synthesis of various biologically active molecules, particularly in the development of novel drugs and therapeutic agents. Chemists utilize its specific stereochemistry and functional groups to design and create tailored pharmaceutical compounds.
Catalog Number | L006817 |
CAS Number | 1279034-86-4 |
Molecular Formula | C13H16N2O4 |
Purity | ≥95% |
Storage | 2-8°C(protect from light) |
IUPAC Name | (2S,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid |
InChI | InChI=1S/C13H16N2O4/c16-12(17)11-6-10(7-14-11)15-13(18)19-8-9-4-2-1-3-5-9/h1-5,10-11,14H,6-8H2,(H,15,18)(H,16,17)/t10-,11-/m0/s1 |
InChIKey | VCZIKOUKWSDDIU-QWRGUYRKSA-N |
SMILES | C1C(CNC1C(=O)O)NC(=O)OCC2=CC=CC=C2 |