Home
>
Reference Standards>ADC-linkers> (2S,4S)-4-Hydroxypyrrolidine-1,2-dicarboxylic Acid 1-tert-Butyl Ester 2-Methyl Ester
For research use only. Not for therapeutic Use.
(2S,4S)-4-Hydroxypyrrolidine-1,2-dicarboxylic Acid 1-tert-Butyl Ester 2-Methyl Ester (Cat No.:R058195) is a complex chiral compound with a five-membered pyrrolidine ring and two stereocenters denoted as (2S,4S). It contains tert-butyl and methyl ester groups, commonly used as protecting groups in organic synthesis. This compound likely serves as a crucial intermediate in the preparation of more intricate molecules for pharmaceutical and chemical research. Its specific structure and properties contribute to its significance as a valuable building block in the development of potential therapeutic agents and advanced materials.
CAS Number | 102195-79-9 |
Synonyms | (2S,4S)-4-Hydroxy-1,2-pyrrolidinedicarboxylic Acid 1-(1,1-Dimethylethyl) 2-Methyl Ester; (2S-cis)-4-Hydroxy-1,2-pyrrolidinedicarboxylic Acid 1-(1,1-Dimethylethyl) 2-Methyl Ester; Methyl (2S,4S)-1-tert-Butoxycarbonyl-4-hydroxypyrrolidine-?2-carboxylat |
Molecular Formula | C11H19NO5 |
Purity | ≥95% |
Target | PROTAC |
Storage | 2-8°C |
IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
InChI | InChI=1S/C11H19NO5/c1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h7-8,13H,5-6H2,1-4H3/t7-,8-/m0/s1 |
InChIKey | MZMNEDXVUJLQAF-YUMQZZPRSA-N |
SMILES | CC(C)(C)OC(=O)N1CC(CC1C(=O)OC)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |