For research use only. Not for therapeutic Use.
3-Hydroxyisoquinoline (Cat.No:R035989) is a chemical compound with a heterocyclic structure. It finds applications in pharmaceutical and agrochemical industries as a building block for the synthesis of various bioactive compounds. Additionally, it serves as a precursor in the production of dyes and other specialty chemicals.
| Catalog Number | R035989 |
| CAS Number | 7651-81-2 |
| Synonyms | 3-Isoquinolinol; 3(2H)-Isoquinolinone; 3(2H)-Isoquinolone |
| Molecular Formula | C9H7NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2H-isoquinolin-3-one |
| InChI | InChI=1S/C9H7NO/c11-9-5-7-3-1-2-4-8(7)6-10-9/h1-6H,(H,10,11) |
| InChIKey | GYPOFOQUZZUVQL-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=O)NC=C2C=C1 |
