For research use only. Not for therapeutic Use.
3-(1-Hydroxyethyl)pyridine is a pyridine derivative featuring a hydroxyl group attached to an ethyl chain at the 1-position. This compound is notable in organic synthesis and medicinal chemistry due to its potential biological activities, including neuroprotective and anti-inflammatory effects. The presence of the hydroxyl group enhances its solubility and reactivity, allowing for diverse chemical transformations. Its unique structure makes it a valuable intermediate in the synthesis of various pharmaceuticals and bioactive molecules, contributing to research in drug development and chemical applications.
CAS Number | 4754-27-2 |
Molecular Formula | C7H9NO |
Purity | ≥95% |
IUPAC Name | 1-pyridin-3-ylethanol |
InChI | InChI=1S/C7H9NO/c1-6(9)7-3-2-4-8-5-7/h2-6,9H,1H3 |
InChIKey | QMDUEBURHKSKDG-UHFFFAOYSA-N |
SMILES | CC(C1=CN=CC=C1)O |