Home
>
Isotope Labeled Compounds>Other Isotope Labeled Compounds> 3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-propanol-d6
For research use only. Not for therapeutic Use.
3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-propanol-d6(Cat No.:R051708) is a deuterated compound that plays a crucial role in pharmaceutical and chemical synthesis research. Featuring six deuterium atoms, this compound offers enhanced stability and minimal isotopic effect in experimental setups, ensuring precise and reproducible results in NMR spectroscopy and other analytical techniques. It is particularly useful in studying the kinetics and mechanisms of silylation reactions, providing insights into the behavior of silyl ethers in various chemical environments. This specificity makes it a valuable tool for researchers focusing on organosilicon chemistry and its applications.
CAS Number | 1224439-44-4 |
Synonyms | 3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-propan-1,1,2,2,3,3-d6-ol |
Molecular Formula | C₉H₁₆D₆O₂Si |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-1,1,2,2,3,3-hexadeuteriopropan-1-ol |
InChI | InChI=1S/C9H22O2Si/c1-9(2,3)12(4,5)11-8-6-7-10/h10H,6-8H2,1-5H3/i6D2,7D2,8D2 |
InChIKey | NETUFVYVNJNFMU-JEKPXRCASA-N |
SMILES | [2H]C([2H])(C([2H])([2H])O)C([2H])([2H])O[Si](C)(C)C(C)(C)C |