For research use only. Not for therapeutic Use.
3-(1,3,2-Dioxaborinan-2-yl)benzonitrile(CAT: L000456) is a significant compound in the realm of material chemistry. It serves as a key precursor for the synthesis of functionalized organic molecules, specifically in the development of organic electronic materials. This compound’s unique structure and reactivity make it a valuable building block in the design and fabrication of organic electronic devices such as OLEDs (organic light-emitting diodes) and organic semiconductors.
CAS Number | 684648-40-6 |
Molecular Formula | C10H10BNO2 |
Purity | ≥95% |
IUPAC Name | 3-(1,3,2-dioxaborinan-2-yl)benzonitrile |
InChI | InChI=1S/C10H10BNO2/c12-8-9-3-1-4-10(7-9)11-13-5-2-6-14-11/h1,3-4,7H,2,5-6H2 |
InChIKey | JANBWDSIRRHGLC-UHFFFAOYSA-N |