For research use only. Not for therapeutic Use.
3-(1,3,4-Oxadiazol-2-yl)benzoic acid(Cat No.:L007838), is a chemical compound featuring a benzoic acid structure with an oxadiazole ring attached at the 2nd position. Oxadiazole derivatives have attracted attention in medicinal chemistry due to their diverse biological activities, including antimicrobial, anticancer, and anti-inflammatory properties. Compounds like this one are crucial in drug discovery, serving as potential candidates for developing novel medications. Researchers explore their pharmacological effects and utilize them as valuable building blocks in the synthesis of complex organic molecules, contributing significantly to advancements in the field of pharmaceutical research.
CAS Number | 1176505-26-2 |
Molecular Formula | C9H6N2O3 |
Purity | ≥95% |
IUPAC Name | 3-(1,3,4-oxadiazol-2-yl)benzoic acid |
InChI | InChI=1S/C9H6N2O3/c12-9(13)7-3-1-2-6(4-7)8-11-10-5-14-8/h1-5H,(H,12,13) |
InChIKey | MJPAHMZEXVECGY-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)C(=O)O)C2=NN=CO2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |