For research use only, not for therapeutic use.
3-(1H-1,2,3-Triazol-4-yl)pyridine(Cat No.:R036179)is a versatile heterocyclic compound widely utilized in pharmaceutical and biochemical research. This pyridine derivative features a 1,2,3-triazole moiety, enhancing its biological activity and enabling interactions with various targets. Its unique structure makes it a valuable scaffold in drug discovery, particularly in developing novel therapeutics with improved efficacy. The compound’s stability and reactivity allow for diverse modifications, facilitating the synthesis of derivatives with tailored properties. Ideal for medicinal chemistry applications, 3-(1H-1,2,3-Triazol-4-yl)pyridine plays a crucial role in advancing drug development and research.
Catalog Number | R036179 |
CAS Number | 120241-79-4 |
Synonyms | 3-(1H-1,2,3-Triazol-5-yl)pyridine; 1H-1,2,3-Triazole-pyridine; |
Molecular Formula | C7H6N4 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 3-(2H-triazol-4-yl)pyridine |
InChI | InChI=1S/C7H6N4/c1-2-6(4-8-3-1)7-5-9-11-10-7/h1-5H,(H,9,10,11) |
InChIKey | VYXFEFOIYPNBFK-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)C2=NNN=C2 |