Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-(1H-benzimidazol-2-yl)propan-1-amine dihydrochloride
For research use only. Not for therapeutic Use.
3-(1H-benzimidazol-2-yl)propan-1-amine dihydrochloride(Cat No.:L006738), is a chemical compound used in biochemical and pharmaceutical research. This compound contains a benzimidazole ring and an amino group attached to a propane-1-amine backbone, with two hydrochloride groups. Researchers use it as a valuable tool in studying biological processes and in drug development. Its structure suggests potential interactions with specific receptors or enzymes, making it essential for investigations related to cellular pathways and therapeutic target identification.
Catalog Number | L006738 |
CAS Number | 88765-77-9 |
Molecular Formula | C10H15Cl2N3 |
Purity | ≥95% |
IUPAC Name | 3-(1H-benzimidazol-2-yl)propan-1-amine;dihydrochloride |
InChI | InChI=1S/C10H13N3.2ClH/c11-7-3-6-10-12-8-4-1-2-5-9(8)13-10;;/h1-2,4-5H,3,6-7,11H2,(H,12,13);2*1H |
InChIKey | FKTASQBFLHXILH-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)NC(=N2)CCCN.Cl.Cl |