For research use only. Not for therapeutic Use.
3-(1H-Imidazol-1-yl)-5-(trifluoromethyl)-aniline is an organic compound featuring an imidazole group attached to an aniline ring at the 3-position, and a trifluoromethyl group at the 5-position. This compound is valuable in medicinal chemistry and organic synthesis, where it is used as a building block for the development of pharmaceuticals and bioactive molecules. The imidazole ring is a common motif in drugs due to its ability to interact with biological targets, while the trifluoromethyl group enhances the molecule’s metabolic stability and lipophilicity. Researchers explore 3-(1H-Imidazol-1-yl)-5-(trifluoromethyl)-aniline for potential applications in drug discovery and chemical research.
CAS Number | 943320-48-7 |
Molecular Formula | C10H8F3N3 |
Purity | ≥95% |
Storage | Desiccate at +4 ℃ |
IUPAC Name | 3-imidazol-1-yl-5-(trifluoromethyl)aniline |
InChI | InChI=1S/C10H8F3N3/c11-10(12,13)7-3-8(14)5-9(4-7)16-2-1-15-6-16/h1-6H,14H2 |
InChIKey | KZPKULGYMCRGJA-UHFFFAOYSA-N |
SMILES | C1=CN(C=N1)C2=CC(=CC(=C2)C(F)(F)F)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |