For research use only. Not for therapeutic Use.
3-(1H-Indol-1-yl)propanoic acid(CAT: L046380) is a high-quality heterocyclic compound featuring an indole moiety linked to a propanoic acid group. This versatile molecule plays a significant role in pharmaceutical and biochemical research, particularly in the synthesis of bioactive compounds and the development of novel therapeutic agents. Its unique structure makes it valuable for studying molecular interactions and pathways in medicinal chemistry. With consistent purity and reliability, 3-(1H-Indol-1-yl)propanoic acid is an essential tool for innovative research in drug discovery, organic synthesis, and material science, supporting advancements in both academic and industrial settings.
CAS Number | 6639-06-1 |
Molecular Formula | C11H11NO2 |
Purity | ≥95% |
IUPAC Name | 3-indol-1-ylpropanoic acid |
InChI | InChI=1S/C11H11NO2/c13-11(14)6-8-12-7-5-9-3-1-2-4-10(9)12/h1-5,7H,6,8H2,(H,13,14) |
InChIKey | OSWNOVFZARRSKM-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CN2CCC(=O)O |