For research use only. Not for therapeutic Use.
3-(1H-pyrazol-4-yl)benzoic acid(Cat No.:L033171)is a heterocyclic compound featuring a pyrazole ring attached to a benzoic acid core. This structure makes it a versatile intermediate in organic synthesis and pharmaceutical research, particularly in the development of biologically active molecules and potential drug candidates. The combination of the pyrazole and benzoic acid functionalities allows for unique reactivity in various chemical transformations, such as coupling reactions. Researchers in medicinal chemistry use this compound for synthesizing novel therapeutic agents and exploring innovative chemical pathways in drug discovery.
CAS Number | 1002535-21-8 |
Molecular Formula | C10H8N2O2 |
Purity | ≥95% |
IUPAC Name | 3-(1H-pyrazol-4-yl)benzoic acid |
InChI | InChI=1S/C10H8N2O2/c13-10(14)8-3-1-2-7(4-8)9-5-11-12-6-9/h1-6H,(H,11,12)(H,13,14) |
InChIKey | BXSUQWZHUHROLP-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CNN=C2 |