For research use only. Not for therapeutic Use.
3-(2-(2-(2-Aminoethoxy)ethoxy)ethoxy)propanoic Acid(CAT: R022420) is a synthetic compound belonging to the class of organic acids. Its action targets are primarily related to its role as a building block in chemical synthesis. The mode of action involves serving as a versatile intermediate to create various compounds with multiple functionalities. Pharmacologically, this compound is not known to have specific therapeutic actions or direct applications in medicine. However, it can be employed in research, drug development, and industrial processes, such as the synthesis of pharmaceuticals, agrochemicals, and other valuable chemicals, due to its flexible and reactive structure.
CAS Number | 784105-33-5 |
Molecular Formula | C9H19NO5 |
Purity | ≥95% |
Target | PROTAC |
Storage | -20°C |
IUPAC Name | 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoic acid |
InChI | InChI=1S/C9H19NO5/c10-2-4-14-6-8-15-7-5-13-3-1-9(11)12/h1-8,10H2,(H,11,12) |
InChIKey | XUQZKSCQPMNDEY-UHFFFAOYSA-N |
SMILES | C(COCCOCCOCCN)C(=O)O |