Home
>
Chemical Reagents>Organic Building Blocks> 3-(2-Amino-2-carboxyethyl)benzoic acid hydrochloride
For research use only. Not for therapeutic Use.
3-(2-Amino-2-carboxyethyl)benzoic acid hydrochloride(Cat No.:L002956)is a specialized amino acid derivative used in biochemical research and pharmaceutical development. This compound features a benzoic acid core with an amino and carboxyethyl group, making it valuable for studying metabolic pathways and enzyme functions. As a hydrochloride salt, it is more soluble and stable, facilitating its use in various experimental conditions. This compound is often employed in the synthesis of peptides and other bioactive molecules, supporting advanced research in drug discovery, molecular biology, and medicinal chemistry.
CAS Number | 80852-34-2 |
Molecular Formula | C10H12ClNO4 |
Purity | ≥95% |
IUPAC Name | 3-(2-amino-2-carboxyethyl)benzoic acid;hydrochloride |
InChI | InChI=1S/C10H11NO4.ClH/c11-8(10(14)15)5-6-2-1-3-7(4-6)9(12)13;/h1-4,8H,5,11H2,(H,12,13)(H,14,15);1H |
InChIKey | NLSQVXAYBFSSOL-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)C(=O)O)CC(C(=O)O)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |