Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 3-(2-Aminoethyl)-1-Boc-piperidine
For research use only. Not for therapeutic Use.
3-(2-Aminoethyl)-1-Boc-piperidine(Cat No.:L012330), is a piperidine derivative used in organic synthesis and pharmaceutical research. It contains a tert-butoxycarbonyl (Boc) protecting group on the nitrogen atom and an aminoethyl group attached to the piperidine ring. The Boc group shields the amine during chemical reactions. This compound serves as a crucial building block in synthesizing various organic molecules and pharmaceutical agents. Its controlled reactivity enables the introduction of specific functionalities, making it valuable in drug development and medicinal chemistry research.
CAS Number | 259180-77-3 |
Molecular Formula | C12H24N2O2 |
Purity | ≥95% |
Storage | 2–8 °C |
IUPAC Name | tert-butyl 3-(2-aminoethyl)piperidine-1-carboxylate |
InChI | InChI=1S/C12H24N2O2/c1-12(2,3)16-11(15)14-8-4-5-10(9-14)6-7-13/h10H,4-9,13H2,1-3H3 |
InChIKey | GYLAYRXNMUUXJS-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCCC(C1)CCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |