For research use only. Not for therapeutic Use.
3-(2-Aminoethyl)-1H-indole-6-carbonitrile(Cat No.:L007343), is a key chemical compound used in various research and industrial applications. Its unique structure, combining an indole core, an aminoethyl group, and a carbonitrile moiety, makes it valuable in the synthesis of complex organic molecules. Researchers employ this compound as a building block in medicinal chemistry, contributing to the development of novel pharmaceuticals. Its versatile reactivity allows for diverse chemical transformations, making it valuable in the creation of specialty chemicals. Chemists leverage its properties in the design and synthesis of compounds for biological studies and drug discovery efforts.
CAS Number | 467451-88-3 |
Molecular Formula | C11H11N3 |
Purity | ≥95% |
IUPAC Name | 3-(2-aminoethyl)-1H-indole-6-carbonitrile |
InChI | InChI=1S/C11H11N3/c12-4-3-9-7-14-11-5-8(6-13)1-2-10(9)11/h1-2,5,7,14H,3-4,12H2 |
InChIKey | UZXBHUHYYSAFKG-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1C#N)NC=C2CCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |