For research use only. Not for therapeutic Use.
3-[(2-Aminoethyl)dithio]propionic Acid (CAT:R000699) is a chemical compound used in biochemical and pharmaceutical research. It contains an aminoethyl group and a dithiol moiety, making it valuable for applications such as peptide synthesis, enzyme modification, and metal binding studies. Its versatile structure contributes to its significance in diverse scientific investigations.
Catalog Number | R000699 |
CAS Number | 15579-00-7 |
Molecular Formula | C5H11NO2S2 |
Purity | ≥95% |
Target | ADC Linker |
Storage | Store at RT |
IUPAC Name | 3-(2-aminoethyldisulfanyl)propanoic acid |
InChI | InChI=1S/C5H11NO2S2/c6-2-4-10-9-3-1-5(7)8/h1-4,6H2,(H,7,8) |
InChIKey | HMMFDEBVQNRZLJ-UHFFFAOYSA-N |
SMILES | C(CSSCCN)C(=O)O |