3-(2-Bromophenyl)-2-hydroxypropanoic acid（Cat No.:L007848）, with the chemical formula C9H9BrO3. It is a chemical compound characterized by a 2-bromophenyl group attached to a hydroxypropanoic acid moiety. This compound is significant in medicinal chemistry and drug development due to its potential pharmacological properties. Hydroxypropanoic acids are common motifs in various natural products and synthetic pharmaceuticals, often serving as essential structural components. Compounds like these are crucial for researchers in the development of novel drugs, as they offer diverse opportunities for the creation of targeted and effective therapeutic agents against specific diseases or conditions.
| Catalog Number | L007848 |
| CAS Number | 917247-85-9 |
| Molecular Formula | C9H9BrO3 |
| Purity | ≥95% |
| IUPAC Name | 3-(2-bromophenyl)-2-hydroxypropanoic acid |
| InChI | InChI=1S/C9H9BrO3/c10-7-4-2-1-3-6(7)5-8(11)9(12)13/h1-4,8,11H,5H2,(H,12,13) |
| InChIKey | AYQJHOHINJJANF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(C(=O)O)O)Br |
