For research use only. Not for therapeutic Use.
3-(2-Chloroethyl)oxazolidin-2-one(Cat No.:L006706), is a chemical compound featuring an oxazolidin-2-one ring substituted with a chloroethyl group. This compound is essential in organic synthesis, notably utilized as a key intermediate for the preparation of various chemical compounds, including pharmaceuticals and agrochemicals. Its unique structure and reactivity allow for diverse chemical transformations, making it valuable in the development of complex molecules. Researchers leverage 3-(2-chloroethyl)oxazolidin-2-one as a versatile building block, contributing significantly to advancements in drug discovery, materials science, and the synthesis of specialized chemicals for various industrial applications.
CAS Number | 2508-01-2 |
Molecular Formula | C5H8ClNO2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 3-(2-chloroethyl)-1,3-oxazolidin-2-one |
InChI | InChI=1S/C5H8ClNO2/c6-1-2-7-3-4-9-5(7)8/h1-4H2 |
InChIKey | CDYDZTYVCIPLHY-UHFFFAOYSA-N |
SMILES | C1COC(=O)N1CCCl |