For research use only. Not for therapeutic Use.
3-[2-(Ethylhexyl)oxyl]-1,2-propandiol (Cat.No:R057333) is a chemical compound often used in personal care and cosmetic products as a moisturizer and emollient. Its ethylhexyl moiety provides lipophilic properties, enhancing skin absorption. This ingredient contributes to product texture and skin hydration, making it popular in skincare formulations.
| Catalog Number | R057333 |
| CAS Number | 70445-33-9 |
| Synonyms | 3-[(2-Ethylhexyl)oxy]-1,2-propanediol; Glycerol α-(2-Ethylhexyl) Ether; Sensiva SC 50; Sensiva SC 50JP; Ethylhexyl Glycerin; |
| Molecular Formula | C11H24O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-(2-ethylhexoxy)propane-1,2-diol |
| InChI | InChI=1S/C11H24O3/c1-3-5-6-10(4-2)8-14-9-11(13)7-12/h10-13H,3-9H2,1-2H3 |
| InChIKey | NCZPCONIKBICGS-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COCC(CO)O |
| Reference | 1. <span style=”font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”>An, Qinglian, Jiansheng Zha, and Jinrong Xu. "Natural broad-spectrum preservative composition containing citrus grandis fruit extract and its use." U.S. Patent No. 10,342,236. 9 Jul. 2019.<br /> |
![70445-33-9-3-[2-(Ethylhexyl)oxyl]-1,2-propandiol](https://www.musechem.com/uploads/structure/70445-33-9.png)