For research use only. Not for therapeutic Use.
3-(2-Fluorophenyl)propiolic acid(CAT: L029967) is an aromatic acetylenic acid featuring a fluorine-substituted phenyl ring linked to a propiolic acid group. This compound is of interest in medicinal chemistry and organic synthesis, where it acts as a precursor for synthesizing a range of biologically active molecules and drug candidates. The propiolic acid group enables it to participate in reactions such as Sonogashira coupling, click chemistry, and cycloaddition, making it valuable for constructing complex heterocycles and conjugated systems. Researchers often employ 3-(2-Fluorophenyl)propiolic acid in the development of pharmaceuticals and agrochemicals, where the fluorine substitution can enhance metabolic stability, bioavailability, and overall pharmacokinetic properties of derived compounds.
CAS Number | 704-97-2 |
Molecular Formula | C9H5FO2 |
Purity | ≥95% |
IUPAC Name | 3-(2-fluorophenyl)prop-2-ynoic acid |
InChI | InChI=1S/C9H5FO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,(H,11,12) |
InChIKey | STVAOWAAIBCKAN-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |