For research use only. Not for therapeutic Use.
3-(2-Mercaptoethoxy)propanoic acid(CAT: L000449) is a compound with significance in material science and chemical synthesis. In material science, it can be used for the modification of surfaces and the synthesis of materials with unique properties. The thiol group in this compound can be crucial in functionalizing surfaces and enhancing material properties. Additionally, it serves as a valuable reagent in chemical synthesis, allowing for the introduction of thiol-containing groups into organic molecules, providing opportunities for diversifying chemical structures.
CAS Number | 1260092-48-5 |
Molecular Formula | C5H10O3S |
Purity | ≥95% |
IUPAC Name | 3-(2-sulfanylethoxy)propanoic acid |
InChI | InChI=1S/C5H10O3S/c6-5(7)1-2-8-3-4-9/h9H,1-4H2,(H,6,7) |
InChIKey | ZSOWTTJLZBIPQR-UHFFFAOYSA-N |