For research use only. Not for therapeutic Use.
3-(2-Methoxy-5-methylphenyl)-3-phenylpropanol(Cat No.:M016740)is a chemical compound used in pharmaceutical and biochemical research. It features a methoxy group and a methyl group attached to a phenyl ring, along with a phenylpropanol backbone. This structure makes it valuable for studying chemical reactions, metabolic pathways, and compound interactions. Its unique configuration allows it to serve as a precursor or intermediate in the synthesis of more complex molecules. This compound is ideal for applications in drug development, medicinal chemistry, and other advanced research fields.
CAS Number | 124936-75-0 |
Molecular Formula | C22H32ClNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenol;hydrochloride |
InChI | InChI=1S/C22H31NO.ClH/c1-16(2)23(17(3)4)14-13-20(19-9-7-6-8-10-19)21-15-18(5)11-12-22(21)24;/h6-12,15-17,20,24H,13-14H2,1-5H3;1H |
InChIKey | FSUOGWPKKKHHHM-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)O)C(CCN(C(C)C)C(C)C)C2=CC=CC=C2.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |