Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-(2-methoxyphenyl)-2-methylquinazolin-4(3H)-one
For research use only. Not for therapeutic Use.
3-(2-methoxyphenyl)-2-methylquinazolin-4(3H)-one(CAT: L000003) plays a significant role in pharmaceutical and organic chemistry. This compound is widely utilized as a structural scaffold for the development of new drugs and pharmaceutical agents. Its action method involves its incorporation into drug molecules, affecting specific biological targets. In the field of organic chemistry, it is an essential intermediate in the synthesis of various organic compounds.
CAS Number | 4260-28-0 |
Molecular Formula | C16H14N2O2 |
Purity | ≥95% |
IUPAC Name | 3-(2-methoxyphenyl)-2-methylquinazolin-4-one |
InChI | InChI=1S/C16H14N2O2/c1-11-17-13-8-4-3-7-12(13)16(19)18(11)14-9-5-6-10-15(14)20-2/h3-10H,1-2H3 |
InChIKey | YIEVFKLHPPPUSM-UHFFFAOYSA-N |