For research use only. Not for therapeutic Use.
3-(2-Methoxyphenyl)thiophene-2-carboxylic Acid(CAT: L038388) is a high-purity aromatic compound featuring a methoxy-substituted phenyl group attached to a thiophene carboxylic acid framework. This versatile molecule is widely utilized in pharmaceutical research and organic synthesis as a building block for designing bioactive compounds and advanced materials. Its unique structure and reactivity make it valuable for exploring novel therapeutic agents and synthetic pathways. With excellent stability and precise composition, 3-(2-Methoxyphenyl)thiophene-2-carboxylic Acid ensures reliable performance, making it a crucial resource for researchers in drug discovery, materials science, and fine chemical development.
CAS Number | 666841-74-3 |
Molecular Formula | C12H10O3S |
Purity | ≥95% |
IUPAC Name | 3-(2-methoxyphenyl)thiophene-2-carboxylic acid |
InChI | InChI=1S/C12H10O3S/c1-15-10-5-3-2-4-8(10)9-6-7-16-11(9)12(13)14/h2-7H,1H3,(H,13,14) |
InChIKey | QBWDBOONGOMYNQ-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1C2=C(SC=C2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |