For research use only. Not for therapeutic Use.
3-(2-Oxopyrrolidin-1-yl)-5-(trifluoromethyl)benzoic acid(Cat No.:L007517), is a chemical compound featuring a benzoic acid core with a pyrrolidinone group at the 3rd position and a trifluoromethyl substituent at the 5th position. This compound holds significance in medicinal chemistry, often serving as a key scaffold in drug discovery. Its unique structure suggests potential biological activities, making it valuable for further research in the development of pharmaceutical agents.
CAS Number | 1244030-93-0 |
Molecular Formula | C12H10F3NO3 |
Purity | ≥95% |
IUPAC Name | 3-(2-oxopyrrolidin-1-yl)-5-(trifluoromethyl)benzoic acid |
InChI | InChI=1S/C12H10F3NO3/c13-12(14,15)8-4-7(11(18)19)5-9(6-8)16-3-1-2-10(16)17/h4-6H,1-3H2,(H,18,19) |
InChIKey | PMPCVGQVNAPMHY-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(C1)C2=CC(=CC(=C2)C(F)(F)F)C(=O)O |