Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> {3-[2-(Piperidin-1-yl)ethoxy]phenyl}
For research use only. Not for therapeutic Use.
{3-[2-(Piperidin-1-yl)ethoxy]phenyl}(CAT: L009508) is a chemical entity with potential pharmacological significance. Its mode of action involves interactions with specific receptors or enzymes within biological systems, making it a candidate for drug discovery and development. The compound’s structure suggests a role in modulating cellular processes by engaging with target molecules. This property opens avenues for investigating its potential applications in medicinal chemistry, such as in the development of novel therapeutics or as a molecular probe for understanding biological pathways.
Catalog Number | L009508 |
CAS Number | 1311166-07-0 |
Molecular Formula | C13H20BNO3 |
Purity | ≥95% |
IUPAC Name | [3-(2-piperidin-1-ylethoxy)phenyl]boronic acid |
InChI | InChI=1S/C13H20BNO3/c16-14(17)12-5-4-6-13(11-12)18-10-9-15-7-2-1-3-8-15/h4-6,11,16-17H,1-3,7-10H2 |
InChIKey | RVGXCTOOQRWXTB-UHFFFAOYSA-N |