Home
>
Reference Standards> 3-(2-{[(tert-butoxy)carbonyl]amino}propan-2-yl)-1,2-oxazole-5-carboxylic acid
For research use only. Not for therapeutic Use.
3-(2-{[(tert-Butoxy)carbonyl]amino}propan-2-yl)-1,2-oxazole-5-carboxylic acid is a tert-butoxycarbonyl (Boc)-protected amino acid derivative featuring an oxazole ring. This compound is widely used in peptide synthesis and medicinal chemistry due to its Boc-protected amino group, which prevents unwanted reactions during synthesis. The carboxylic acid functionality and oxazole ring make it a valuable intermediate for creating bioactive molecules. Its structure supports diverse modifications, making it suitable for developing complex peptides and small molecules in pharmaceutical research and drug discovery.
CAS Number | 1803608-31-2 |
Molecular Formula | C12H18N2O5 |
Purity | 95% |
Documentation | |
IUPAC Name | 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]-1,2-oxazole-5-carboxylic acid |
InChI | 1S/C12H18N2O5/c1-11(2,3)18-10(17)13-12(4,5)8-6-7(9(15)16)19-14-8/h6H,1-5H3,(H,13,17)(H,15,16) |
InChIKey | ZBWNYTFBHATIGP-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC(C)(C)C1=NOC(=C1)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |