For research use only. Not for therapeutic Use.
3-(2-Thienyl)-DL-alanine(Cat No.:I042992)is an aromatic amino acid derivative in which a 2-thienyl group (a sulfur-containing benzene ring) is attached to the side chain of DL-alanine. The thienyl group imparts unique electronic and structural properties, making this compound potentially useful in medicinal chemistry. It can serve as a building block for designing bioactive molecules with enhanced stability and biological activity. The compound may have applications in drug development, particularly in the fields of neurochemistry, cancer research, and antimicrobial therapies, where aromatic amino acid derivatives play a significant role in modulating protein interactions and enzyme activities.
CAS Number | 2021-58-1 |
Synonyms | 2-amino-3-thiophen-2-ylpropanoic acid |
Molecular Formula | C7H9NO2S |
Purity | ≥95% |
IUPAC Name | 2-amino-3-thiophen-2-ylpropanoic acid |
InChI | InChI=1S/C7H9NO2S/c8-6(7(9)10)4-5-2-1-3-11-5/h1-3,6H,4,8H2,(H,9,10) |
InChIKey | WTOFYLAWDLQMBZ-UHFFFAOYSA-N |
SMILES | C1=CSC(=C1)CC(C(=O)O)N |