For research use only. Not for therapeutic Use.
3-([2,2′-Bipyridin]-5-yl)-2-aminopropanoic acid hydrochloride is a complex organic molecule that combines a bipyridine ligand with an amino acid structure, specifically propanoic acid. This compound, particularly in its hydrochloride form, is primarily used in coordination chemistry for creating metal complexes that have potential applications in catalysis and as photosensitizers in solar energy conversion. Its bipyridine component facilitates the binding to metals, enhancing the stability and electronic properties of the complexes formed.
Catalog Number | R060212 |
CAS Number | 2044702-29-4 |
Synonyms | 3-([2,2′-Bipyridin]-5-yl)-2-aminopropanoic acid hydrochloride; |
Molecular Formula | C13H14ClN3O2 |
Purity | ≥95% |
IUPAC Name | 2-amino-3-(6-pyridin-2-ylpyridin-3-yl)propanoic acid;hydrochloride |
InChI | InChI=1S/C13H13N3O2.ClH/c14-10(13(17)18)7-9-4-5-12(16-8-9)11-3-1-2-6-15-11;/h1-6,8,10H,7,14H2,(H,17,18);1H |
InChIKey | YGFVUABWQMQJDI-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C2=NC=C(C=C2)CC(C(=O)O)N.Cl |