For research use only. Not for therapeutic Use.
3-(2,3-Dihydro-1H-indol-1-yl)propan-1-amine(Cat No.:L015529)is a versatile compound used in pharmaceutical research and organic synthesis. Featuring an indoline ring linked to a propylamine chain, this compound is a key intermediate in the development of various bioactive molecules, including potential therapeutic agents. Its structure allows for diverse chemical modifications, making it valuable in medicinal chemistry for the synthesis of complex heterocyclic compounds. With high purity and consistent quality, it supports advanced research in drug discovery, facilitating the creation of innovative treatments and chemical entities.
CAS Number | 61123-70-4 |
Molecular Formula | C11H16N2 |
Purity | ≥95% |
IUPAC Name | 3-(2,3-dihydroindol-1-yl)propan-1-amine |
InChI | InChI=1S/C11H16N2/c12-7-3-8-13-9-6-10-4-1-2-5-11(10)13/h1-2,4-5H,3,6-9,12H2 |
InChIKey | NRUUORGEWIRLJT-UHFFFAOYSA-N |
SMILES | C1CN(C2=CC=CC=C21)CCCN |