Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-N-propylpropanamide
For research use only. Not for therapeutic Use.
3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-N-propylpropanamide(Cat No.:L007241), is a chemical compound significant in medicinal chemistry research. This compound contains a pyrrole ring with a propylpropanamide moiety and exhibits potential biological activities. Researchers investigate derivatives of this compound for their interactions with biological targets, making it valuable in drug discovery efforts. The specific structure of the pyrrole ring and the amide functional group enhances its reactivity, allowing for modifications to design new molecules. These modifications enable the creation of novel bioactive agents, contributing to advancements in medicinal chemistry and pharmaceutical research.
Catalog Number | L007241 |
CAS Number | 1247521-37-4 |
Molecular Formula | C10H14N2O3 |
Purity | ≥95% |
IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-propylpropanamide |
InChI | InChI=1S/C10H14N2O3/c1-2-6-11-8(13)5-7-12-9(14)3-4-10(12)15/h3-4H,2,5-7H2,1H3,(H,11,13) |
InChIKey | OLHOMIBJLGPOAE-UHFFFAOYSA-N |
SMILES | CCCNC(=O)CCN1C(=O)C=CC1=O |