For research use only. Not for therapeutic Use.
3-(2,5-Dioxoimidazolidin-4-yl)propanoic acid (Cat No.:C000972) is an organic compound with the molecular formula C7H8N2O4. It is a white crystalline powder with an imidazolidinone ring structure and a carboxylic acid group. This compound is used in pharmaceutical research and drug development due to its potential as a building block for certain drugs and bioactive molecules. It possesses unique properties and functional groups that make it valuable in medicinal chemistry and related fields.
Catalog Number | C000972 |
CAS Number | 5624-26-0 |
Synonyms | Carglumic Acid Impurity B; 2,5-Dioxo-4-imidazolidinepropionic Acid; 3-(2,4-Dioxoimidazolidin-5-yl)propanoic Acid; 5-Hydantoinpropionic Acid; DL-5-(2-Carboxyethyl)hydantoin; NSC 23606; |
Molecular Formula | C₆H₈N₂O₄ |
Purity | ≥95% |
Solubility | DMSO (Slightly), Methanol (Slightly) |
Appearance | White to Off-White Solid |
Storage | 2-8°C, Hygroscopic |
IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)propanoic acid |
InChI | InChI=1S/C6H8N2O4/c9-4(10)2-1-3-5(11)8-6(12)7-3/h3H,1-2H2,(H,9,10)(H2,7,8,11,12) |
InChIKey | VWFWNXQAMGDPGG-UHFFFAOYSA-N |
SMILES | C(CC(=O)O)C1C(=O)NC(=O)N1 |
Reference | Shao, Y., et al.: J. Proteome Res., 14, 906-916 (2015) |