For research use only. Not for therapeutic Use.
3-(3-Bromophenyl)morpholine(Cat No.:L007867), with the chemical formula C11H12BrNO. It is a heterocyclic compound featuring a morpholine ring substituted with a 3-bromophenyl group. Compounds with similar morpholine motifs are important in medicinal chemistry and drug discovery due to their diverse biological activities. The incorporation of a bromine atom enhances the compound’s reactivity, allowing for various chemical transformations. This compound’s unique structure makes it valuable for the development of potential drugs, as researchers explore its interactions with biological targets, contributing to advancements in pharmaceutical science and the design of novel therapeutic agents.
CAS Number | 1260665-00-6 |
Molecular Formula | C10H12BrNO |
Purity | ≥95% |
IUPAC Name | 3-(3-bromophenyl)morpholine |
InChI | InChI=1S/C10H12BrNO/c11-9-3-1-2-8(6-9)10-7-13-5-4-12-10/h1-3,6,10,12H,4-5,7H2 |
InChIKey | PVXORKMUACYCGX-UHFFFAOYSA-N |
SMILES | C1COCC(N1)C2=CC(=CC=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |