For research use only. Not for therapeutic Use.
3-(3-Chlorophenyl)prop-2-yn-1-ol is an organic compound characterized by a prop-2-yn-1-ol structure attached to a 3-chlorophenyl group. Its chemical formula is C₁₀H₈ClO, featuring a triple bond (alkyne) between the second and third carbon atoms and a hydroxyl (–OH) group on the first carbon. This compound is of interest in synthetic organic chemistry for its potential applications in pharmaceuticals and agrochemicals. The presence of the chlorine atom enhances its reactivity, allowing for various functional transformations in chemical synthesis.
Catalog Number | L019131 |
CAS Number | 80151-33-3 |
Molecular Formula | C9H7ClO |
Purity | ≥95% |
IUPAC Name | 3-(3-chlorophenyl)prop-2-yn-1-ol |
InChI | InChI=1S/C9H7ClO/c10-9-5-1-3-8(7-9)4-2-6-11/h1,3,5,7,11H,6H2 |
InChIKey | JSWQDMZGLWMJEG-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)Cl)C#CCO |