For research use only. Not for therapeutic Use.
3-(3-cyanophenyl)-1,2-oxazole-5-carboxylic acid(Cat No.:M346279) is a chemical compound with potential pharmaceutical applications. It belongs to the oxazole class of compounds, which are known for their diverse biological activities. This specific compound contains a cyanophenyl group and a carboxylic acid group attached to an oxazole ring. Compounds similar to 3-(3-cyanophenyl)-1,2-oxazole-5-carboxylic acid have been studied for their potential as antibacterial, antifungal, and anticancer agents. The presence of both a cyano group and a carboxylic acid group in its structure suggests the potential for bioconjugation or modification to enhance its pharmacological properties.
CAS Number | 1152531-77-5 |
Molecular Formula | C11H6N2O3 |
Purity | 95% |
Documentation | |
IUPAC Name | 3-(3-cyanophenyl)-1,2-oxazole-5-carboxylic acid |
InChI | InChI=1S/C11H6N2O3/c12-6-7-2-1-3-8(4-7)9-5-10(11(14)15)16-13-9/h1-5H,(H,14,15) |
InChIKey | TZDONYAQYVKDDH-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)C2=NOC(=C2)C(=O)O)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |