For research use only. Not for therapeutic Use.
3-(3-Hydroxyphenyl)propiolic acid(Cat No.:L007573), is a chemical compound characterized by a propiolic acid group attached to a phenyl ring with a hydroxy group at the 3-position. This unique structure gives it relevance in both organic synthesis and pharmaceutical research. Scientists utilize it as a valuable building block for the synthesis of complex molecules. Its distinctive chemical properties, including its aromatic ring and acidic functional group, make it versatile in chemical reactions.
CAS Number | 10401-10-2 |
Molecular Formula | C9H6O3 |
Purity | ≥95% |
IUPAC Name | 3-(3-hydroxyphenyl)prop-2-ynoic acid |
InChI | InChI=1S/C9H6O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,(H,11,12) |
InChIKey | FQYMOUWEHRAVLI-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)O)C#CC(=O)O |