For research use only. Not for therapeutic Use.
3-(3-Methoxyphenyl)benzaldehyde（Cat No.:M115223）is an important aromatic aldehyde used in the synthesis of various organic compounds, particularly in pharmaceutical and fragrance industries. Its structure, featuring a methoxy group attached to a phenyl ring, provides it with unique chemical properties, making it a valuable intermediate in the creation of bioactive molecules. This compound is often employed in the development of drugs and fine chemicals, serving as a key building block in complex organic syntheses. Its versatility makes it a critical component in medicinal chemistry and material science.
| Catalog Number | M115223 |
| CAS Number | 126485-58-3 |
| Molecular Formula | C14H12O2 |
| Purity | ≥95% |
| IUPAC Name | 3-(3-methoxyphenyl)benzaldehyde |
| InChI | InChI=1S/C14H12O2/c1-16-14-7-3-6-13(9-14)12-5-2-4-11(8-12)10-15/h2-10H,1H3 |
| InChIKey | GLGWNAPAIMXRGT-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC=CC(=C2)C=O |
