Home
>
Chemical Reagents>Organic Building Blocks> 3-[3-(Trifluoromethyl)phenyl]propan-1-amine hydrochloride
For research use only. Not for therapeutic Use.
3-[3-(Trifluoromethyl)phenyl]propan-1-amine hydrochloride(Cat No.:L007311), is a chemical compound with diverse applications in pharmaceutical and research fields. Its molecular structure includes a propan-1-amine group attached to a phenyl ring, which in turn carries a trifluoromethyl substituent. This compound, in its hydrochloride form, is widely utilized in medicinal chemistry for the development of novel drugs and therapeutic agents due to its biological activity. Researchers often employ it as a building block in the synthesis of more complex molecules, enabling the creation of diverse chemical libraries for drug discovery efforts. Additionally, it finds applications in various chemical research endeavors and is a valuable tool in the exploration of new chemical entities.
CAS Number | 104774-93-8 |
Molecular Formula | C10H13ClF3N |
Purity | ≥95% |
IUPAC Name | 3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
InChI | InChI=1S/C10H12F3N.ClH/c11-10(12,13)9-5-1-3-8(7-9)4-2-6-14;/h1,3,5,7H,2,4,6,14H2;1H |
InChIKey | NILRPDXPEDEDEI-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)C(F)(F)F)CCCN.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |