For research use only. Not for therapeutic Use.
3-(3,4-Dimethoxyphenyl)propylamine（Cat No.:M139500） is a chemical compound. It is also known as mescaline, a naturally occurring psychedelic alkaloid. Mescaline is found in various cactus species, most notably in peyote (Lophophora williamsii), where it is used in traditional religious ceremonies. Mescaline is a psychoactive substance that can induce altered states of consciousness, visual hallucinations, and changes in perception, thought, and mood.
| Catalog Number | M139500 |
| CAS Number | 14773-42-3 |
| Molecular Formula | C11H17NO2 |
| Purity | ≥95% |
| Storage | Desiccate at +4C |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)propan-1-amine |
| InChI | InChI=1S/C11H17NO2/c1-13-10-6-5-9(4-3-7-12)8-11(10)14-2/h5-6,8H,3-4,7,12H2,1-2H3 |
| InChIKey | WYYQSKUMIFPNFW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCCN)OC |
