For research use only. Not for therapeutic Use.
3-(3,4-Dimethoxyphenyl)-7-hydroxy-4H-chromen-4-one(Cat No.:R036113), also known as 7-Hydroxyflavone, is a naturally occurring flavonoid with significant pharmacological properties. Found in various plants, it exhibits potent antioxidant, anti-inflammatory, and anticancer activities. This compound is studied for its neuroprotective effects, potentially benefiting conditions like Alzheimer’s disease and other neurodegenerative disorders. Its chemical structure, featuring hydroxyl and methoxy groups, enhances its biological activity and stability. Research into 3-(3,4-Dimethoxyphenyl)-7-hydroxy-4H-chromen-4-one continues to explore its therapeutic potential and applications in developing novel treatments for various diseases.
CAS Number | 24160-14-3 |
Molecular Formula | C17H14O5 |
Purity | ≥95% |
IUPAC Name | 3-(3,4-dimethoxyphenyl)-7-hydroxychromen-4-one |
InChI | InChI=1S/C17H14O5/c1-20-14-6-3-10(7-16(14)21-2)13-9-22-15-8-11(18)4-5-12(15)17(13)19/h3-9,18H,1-2H3 |
InChIKey | VFZIJLPRJAQGFO-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |