For research use only. Not for therapeutic Use.
3-(4-(1,2-Diphenylbut-1-enyl)phenyl)acrylic Acid（Cat No.:M100454） is a specialized organic compound used in pharmaceutical and biochemical research. This molecule features a unique structure with a diphenylbutenyl group attached to a phenyl acrylic acid, making it valuable for studying molecular interactions and synthetic pathways. Its high purity and stability ensure reliable results in experimental setups. 3-(4-(1,2-Diphenylbut-1-enyl)phenyl)acrylic Acid is essential for developing new therapeutic agents and exploring innovative drug design strategies, contributing significantly to advancements in medicinal chemistry and pharmaceutical sciences.
| CAS Number | 155701-61-4 |
| Synonyms | 3-(4-(1,2-diphenylbut-1-enyl)phenyl)acrylic acid |
| Molecular Formula | C25H22O2 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | (E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]prop-2-enoic acid |
| InChI | InChI=1S/C25H22O2/c1-2-23(20-9-5-3-6-10-20)25(21-11-7-4-8-12-21)22-16-13-19(14-17-22)15-18-24(26)27/h3-18H,2H2,1H3,(H,26,27)/b18-15+,25-23- |
| InChIKey | HJQQVNIORAQATK-DDJBQNAASA-N |
| SMILES | CCC(=C(C1=CC=CC=C1)C2=CC=C(C=C2)C=CC(=O)O)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
