For research use only. Not for therapeutic Use.
3-(4-Aminophenoxy)propan-1-ol(Cat No.:L007756), is a chemical compound represented by the formula C₉H₁3NO₂. This compound consists of a propanol molecule (C₃H₇OH) with a 4-aminophenoxy group attached to the third carbon atom. The presence of the amino (NH₂) and phenoxy (C₆H₅O) groups gives this compound unique chemical properties. It can be utilized as a building block or intermediate in organic synthesis, especially in the production of pharmaceuticals, agrochemicals, and other specialty chemicals. The specific applications of 3-(4-aminophenoxy)propan-1-ol would depend on its reactivity and compatibility with other compounds in a given chemical process.
CAS Number | 99190-16-6 |
Molecular Formula | C9H13NO2 |
Purity | ≥95% |
IUPAC Name | 3-(4-aminophenoxy)propan-1-ol |
InChI | InChI=1S/C9H13NO2/c10-8-2-4-9(5-3-8)12-7-1-6-11/h2-5,11H,1,6-7,10H2 |
InChIKey | OHLRTNAZWWQJJT-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1N)OCCCO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |