Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-(4-aminophenyl)-1-methyl-1H-pyrazole-4-carboxylic acid
For research use only. Not for therapeutic Use.
3-(4-Aminophenyl)-1-methyl-1H-pyrazole-4-carboxylic Acid(Cat No.:L007758), is a chemical compound with the molecular formula C₁₀H₁₀N₄O₂. This compound features a pyrazole ring (a five-membered aromatic ring containing two nitrogen atoms) with an aminophenyl group and a carboxylic acid functional group. The presence of these moieties makes them valuable in medicinal chemistry, potentially serving as a core structure for drug development. Researchers might explore its biological activities, pharmacological properties, and potential therapeutic applications, ranging from antimicrobial to anticancer properties. Its specific uses and mechanisms of action would be determined through further research and testing in the field of pharmaceutical sciences.
Catalog Number | L007758 |
CAS Number | 1197965-65-3 |
Molecular Formula | C11H11N3O2 |
Purity | ≥95% |
IUPAC Name | 3-(4-aminophenyl)-1-methylpyrazole-4-carboxylic acid |
InChI | InChI=1S/C11H11N3O2/c1-14-6-9(11(15)16)10(13-14)7-2-4-8(12)5-3-7/h2-6H,12H2,1H3,(H,15,16) |
InChIKey | YVJTZYQAEADMNF-UHFFFAOYSA-N |
SMILES | CN1C=C(C(=N1)C2=CC=C(C=C2)N)C(=O)O |