For research use only. Not for therapeutic Use.
3-(4-Aminophenyl)-4-Bromo-1-Methylpyrazole(CAT: M040272) is a high-purity heterocyclic compound featuring a pyrazole core with a 4-bromo substitution, a methyl group, and a 4-aminophenyl moiety. This versatile molecule is widely utilized in pharmaceutical and chemical research, serving as a key intermediate in the synthesis of complex organic compounds and bioactive molecules. Its unique combination of functional groups makes it particularly valuable in medicinal chemistry for exploring novel therapeutic agents and studying biological pathways. With reliable quality and excellent stability, 3-(4-Aminophenyl)-4-Bromo-1-Methylpyrazole supports cutting-edge research in drug discovery and advanced synthetic applications.
Catalog Number | M040272 |
CAS Number | 175276-41-2 |
Molecular Formula | C10H10BrN3 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 4-(4-bromo-1-methylpyrazol-3-yl)aniline |
InChI | InChI=1S/C10H10BrN3/c1-14-6-9(11)10(13-14)7-2-4-8(12)5-3-7/h2-6H,12H2,1H3 |
InChIKey | JLWUWUJJHGPJCF-UHFFFAOYSA-N |
SMILES | CN1C=C(C(=N1)C2=CC=C(C=C2)N)Br |