Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-(4-Bromo-7-fluoro-1-oxoisoindolin-2-yl)piperidine-2,6-dione
For research use only. Not for therapeutic Use.
3-(4-Bromo-7-fluoro-1-oxoisoindolin-2-yl)piperidine-2,6-dione(CAT: L000036) is a chemical compound of significance primarily in pharmaceutical and organic chemistry. In the pharmaceutical field, it serves as a key intermediate in the synthesis of various medications, impacting specific biological targets. Its action method involves its incorporation into drug molecules, contributing to the development of novel pharmaceutical agents.
Catalog Number | L000036 |
CAS Number | 2438239-34-8 |
Molecular Formula | C13H10BrFN2O3 |
Purity | ≥95% |
IUPAC Name | 3-(7-bromo-4-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
InChI | InChI=1S/C13H10BrFN2O3/c14-7-1-2-8(15)11-6(7)5-17(13(11)20)9-3-4-10(18)16-12(9)19/h1-2,9H,3-5H2,(H,16,18,19) |
InChIKey | CTDLBQHVRCGINQ-UHFFFAOYSA-N |