For research use only. Not for therapeutic Use.
3-(4-Bromophenyl)-1H-pyrazole is a heterocyclic compound featuring a pyrazole ring substituted by a 4-bromophenyl group. This compound is significant in medicinal chemistry due to its potential biological activities, including anti-inflammatory, antitumor, and antimicrobial properties. The presence of the bromine atom enhances its reactivity, facilitating further chemical transformations and modifications. Its unique structure makes it a valuable scaffold for the development of novel therapeutic agents and in the synthesis of bioactive compounds, contributing to advancements in drug discovery.
Catalog Number | L012421 |
CAS Number | 73387-46-9 |
Molecular Formula | C9H7BrN2 |
Purity | ≥95% |
IUPAC Name | 5-(4-bromophenyl)-1H-pyrazole |
InChI | InChI=1S/C9H7BrN2/c10-8-3-1-7(2-4-8)9-5-6-11-12-9/h1-6H,(H,11,12) |
InChIKey | LXDGTEBHVOKDLE-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CC=NN2)Br |