For research use only. Not for therapeutic Use.
3-((4-Bromophenyl)amino)propanoic acid(CAT: L029355) is a high-purity aromatic amino acid widely used in pharmaceutical and chemical research. Featuring a propanoic acid backbone with a 4-bromophenylamino group, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, including drug candidates and fine chemicals. Its unique structure and reactivity make it particularly valuable for medicinal chemistry applications, such as the development of enzyme inhibitors and receptor modulators. 3-((4-Bromophenyl)amino)propanoic acid ensures consistent performance and reliability, supporting innovative research in drug discovery and advanced organic synthesis.
CAS Number | 90561-83-4 |
Molecular Formula | C9H10BrNO2 |
Purity | ≥95% |
IUPAC Name | 3-(4-bromoanilino)propanoic acid |
InChI | InChI=1S/C9H10BrNO2/c10-7-1-3-8(4-2-7)11-6-5-9(12)13/h1-4,11H,5-6H2,(H,12,13) |
InChIKey | MRQMMZRTPYMDPW-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1NCCC(=O)O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |