For research use only. Not for therapeutic Use.
3-(4-Bromophenyl)propan-1-amine is a brominated aromatic amine featuring a three-carbon chain with an amino group attached to a 4-bromophenyl ring. This compound is commonly utilized as a building block in organic synthesis, particularly in the development of pharmaceuticals and bioactive molecules. The bromine atom on the phenyl ring allows for further functionalization, enhancing its versatility in chemical reactions. With stability and reactivity, 3-(4-Bromophenyl)propan-1-amine aids in the efficient synthesis of complex compounds for medicinal research and development.
Catalog Number | L012918 |
CAS Number | 65984-53-4 |
Molecular Formula | C9H12BrN |
Purity | ≥95% |
IUPAC Name | 3-(4-bromophenyl)propan-1-amine |
InChI | InChI=1S/C9H12BrN/c10-9-5-3-8(4-6-9)2-1-7-11/h3-6H,1-2,7,11H2 |
InChIKey | WSHIIAOBOIOENJ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CCCN)Br |