For research use only. Not for therapeutic Use.
3-(4-Chlorophenoxy)propionic acid(Cat No.:M224789)is a chemical compound that serves as a critical synthetic intermediate in the pharmaceutical and agricultural industries. It features a 4-chlorophenoxy group attached to a propionic acid backbone, making it useful in the synthesis of herbicides, plant growth regulators, and various organic molecules. The chlorophenoxy moiety enhances its activity in interfering with plant hormone pathways, leading to its application in controlling undesirable vegetation. Additionally, its versatile structure is exploited in medicinal chemistry for developing novel drug candidates with potential anti-inflammatory and analgesic properties.
Catalog Number | M224789 |
CAS Number | 3284-79-5 |
Molecular Formula | C9H9ClO3 |
Purity | ≥95% |
IUPAC Name | 3-(4-chlorophenoxy)propanoic acid |
InChI | InChI=1S/C9H9ClO3/c10-7-1-3-8(4-2-7)13-6-5-9(11)12/h1-4H,5-6H2,(H,11,12) |
InChIKey | OWHJDUCBLVMRBJ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1OCCC(=O)O)Cl |